C12H19N5O2S2 — CID 124750108
(3R)-1-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]piperidine-3-carboxamide (PubChem CID 124750108) has the molecular formula C12H19N5O2S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is (3R)-1-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 124750108 |
| Molecular Formula | C12H19N5O2S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (3R)-1-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]piperidine-3-carboxamide |
| SMILES | CCSc1nnc(NC(=O)CN2CCC[C@@H](C(N)=O)C2)s1 |
| InChI | InChI=1S/C12H19N5O2S2/c1-2-20-12-16-15-11(21-12)14-9(18)7-17-5-3-4-8(6-17)10(13)19/h8H,2-7H2,1H3,(H2,13,19)(H,14,15,18)/t8-/m1/s1 |
| InChIKey | CDSOPWMXSRVRTE-MRVPVSSYSA-N |
| XLogP | 0.79 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|