C15H20N6O2S2 — CID 91833509
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]acetamide (PubChem CID 91833509) has the molecular formula C15H20N6O2S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 91833509 |
| Molecular Formula | C15H20N6O2S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]acetamide |
| SMILES | CCSc1nnc(NC(=O)CN2CCN(C(=O)c3ccc[nH]3)CC2)s1 |
| InChI | InChI=1S/C15H20N6O2S2/c1-2-24-15-19-18-14(25-15)17-12(22)10-20-6-8-21(9-7-20)13(23)11-4-3-5-16-11/h3-5,16H,2,6-10H2,1H3,(H,17,18,22) |
| InChIKey | UWRARQABDGPHGX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|