C14H21N7OS2 — CID 124756426
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]acetamide (PubChem CID 124756426) has the molecular formula C14H21N7OS2 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 124756426 |
| Molecular Formula | C14H21N7OS2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]acetamide |
| SMILES | CCSc1nnc(NC(=O)CN2CCC[C@H](c3n[nH]c(C)n3)C2)s1 |
| InChI | InChI=1S/C14H21N7OS2/c1-3-23-14-20-19-13(24-14)16-11(22)8-21-6-4-5-10(7-21)12-15-9(2)17-18-12/h10H,3-8H2,1-2H3,(H,15,17,18)(H,16,19,22)/t10-/m0/s1 |
| InChIKey | SQLSPMNXAOTCNG-JTQLQIEISA-N |
| XLogP | 1.89 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|