C14H19N5O2S2 — CID 125171675
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2R)-2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetamide (PubChem CID 125171675) has the molecular formula C14H19N5O2S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2R)-2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2R)-2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 125171675 |
| Molecular Formula | C14H19N5O2S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2R)-2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]acetamide |
| SMILES | CCSc1nnc(NC(=O)CN2CCC[C@@H]2c2cc(C)no2)s1 |
| InChI | InChI=1S/C14H19N5O2S2/c1-3-22-14-17-16-13(23-14)15-12(20)8-19-6-4-5-10(19)11-7-9(2)18-21-11/h7,10H,3-6,8H2,1-2H3,(H,15,16,20)/t10-/m1/s1 |
| InChIKey | OBPUPSXKLRAJGH-SNVBAGLBSA-N |
| XLogP | 2.72 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|