C20H23F3N6O3 — CID 45252234
5-oxo-N-[[7-[[4-(trifluoromethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 45252234) has the molecular formula C20H23F3N6O3 and a molecular weight of 452.44 g/mol. Its IUPAC name is 5-oxo-N-[[7-[[4-(trifluoromethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 5-oxo-N-[[7-[[4-(trifluoromethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45252234 |
| Molecular Formula | C20H23F3N6O3 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 5-oxo-N-[[7-[[4-(trifluoromethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C1CCC(C(=O)NCc2nnc3n2CCN(Cc2ccc(OC(F)(F)F)cc2)CC3)N1 |
| InChI | InChI=1S/C20H23F3N6O3/c21-20(22,23)32-14-3-1-13(2-4-14)12-28-8-7-16-26-27-17(29(16)10-9-28)11-24-19(31)15-5-6-18(30)25-15/h1-4,15H,5-12H2,(H,24,31)(H,25,30) |
| InChIKey | DUWGWDRGEGLILA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |