C17H16F6N4O2 — CID 129358054
2-[4-(trifluoromethoxy)phenyl]-N-[[(7S)-7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide (PubChem CID 129358054) has the molecular formula C17H16F6N4O2 and a molecular weight of 422.33 g/mol. Its IUPAC name is 2-[4-(trifluoromethoxy)phenyl]-N-[[(7S)-7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide.
| Compound Name | 2-[4-(trifluoromethoxy)phenyl]-N-[[(7S)-7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 129358054 |
| Molecular Formula | C17H16F6N4O2 |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[4-(trifluoromethoxy)phenyl]-N-[[(7S)-7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)NCc1nnc2n1CC[C@H](C(F)(F)F)C2 |
| InChI | InChI=1S/C17H16F6N4O2/c18-16(19,20)11-5-6-27-13(8-11)25-26-14(27)9-24-15(28)7-10-1-3-12(4-2-10)29-17(21,22)23/h1-4,11H,5-9H2,(H,24,28)/t11-/m0/s1 |
| InChIKey | ZZVJOQLYXNVGOB-NSHDSACASA-N |
| XLogP | 3.16 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |