C30H34FN5O4 — CID 45253170
N-[[2-(dimethylamino)-5,6,7-trimethoxyquinolin-3-yl]methyl]-N-[2-(4-fluorophenyl)ethyl]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide (PubChem CID 45253170) has the molecular formula C30H34FN5O4 and a molecular weight of 547.63 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5,6,7-trimethoxyquinolin-3-yl]methyl]-N-[2-(4-fluorophenyl)ethyl]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | N-[[2-(dimethylamino)-5,6,7-trimethoxyquinolin-3-yl]methyl]-N-[2-(4-fluorophenyl)ethyl]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 45253170 |
| Molecular Formula | C30H34FN5O4 |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | N-[[2-(dimethylamino)-5,6,7-trimethoxyquinolin-3-yl]methyl]-N-[2-(4-fluorophenyl)ethyl]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
| SMILES | COc1cc2nc(N(C)C)c(CN(CCc3ccc(F)cc3)C(=O)c3n[nH]c4c3CCC4)cc2c(OC)c1OC |
| InChI | InChI=1S/C30H34FN5O4/c1-35(2)29-19(15-22-24(32-29)16-25(38-3)28(40-5)27(22)39-4)17-36(14-13-18-9-11-20(31)12-10-18)30(37)26-21-7-6-8-23(21)33-34-26/h9-12,15-16H,6-8,13-14,17H2,1-5H3,(H,33,34) |
| InChIKey | IPDDQHGCPJKLHF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |