C19H21N3O6S2 — CID 45254012
3-[[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3,5-dihydro-2H-1,4-diazepin-4-yl]sulfonyl]aniline (PubChem CID 45254012) has the molecular formula C19H21N3O6S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 3-[[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3,5-dihydro-2H-1,4-diazepin-4-yl]sulfonyl]aniline.
| Compound Name | 3-[[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3,5-dihydro-2H-1,4-diazepin-4-yl]sulfonyl]aniline |
|---|---|
| PubChem CID | 45254012 |
| Molecular Formula | C19H21N3O6S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 3-[[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3,5-dihydro-2H-1,4-diazepin-4-yl]sulfonyl]aniline |
| SMILES | Nc1cccc(S(=O)(=O)N2CC=CN(S(=O)(=O)c3ccc4c(c3)OCCO4)CC2)c1 |
| InChI | InChI=1S/C19H21N3O6S2/c20-15-3-1-4-16(13-15)29(23,24)21-7-2-8-22(10-9-21)30(25,26)17-5-6-18-19(14-17)28-12-11-27-18/h1-6,8,13-14H,7,9-12,20H2 |
| InChIKey | ZPQHHEDAHFUWMJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|