C26H28N4O2 — CID 45254237
4-[(1R,2S)-2-amino-1,2-diphenylethyl]-N-benzoylpiperazine-1-carboxamide (PubChem CID 45254237) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 4-[(1R,2S)-2-amino-1,2-diphenylethyl]-N-benzoylpiperazine-1-carboxamide.
| Compound Name | 4-[(1R,2S)-2-amino-1,2-diphenylethyl]-N-benzoylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 45254237 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 4-[(1R,2S)-2-amino-1,2-diphenylethyl]-N-benzoylpiperazine-1-carboxamide |
| SMILES | N[C@@H](c1ccccc1)[C@@H](c1ccccc1)N1CCN(C(=O)NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H28N4O2/c27-23(20-10-4-1-5-11-20)24(21-12-6-2-7-13-21)29-16-18-30(19-17-29)26(32)28-25(31)22-14-8-3-9-15-22/h1-15,23-24H,16-19,27H2,(H,28,31,32)/t23-,24+/m0/s1 |
| InChIKey | LIFUNOCTVFWOGI-BJKOFHAPSA-N |
| XLogP | 3.60 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |