C26H25NO5 — CID 45255373
8-(methoxymethyl)-2-[(4-methylbenzoyl)-propan-2-ylamino]dibenzofuran-3-carboxylic acid (PubChem CID 45255373) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is 8-(methoxymethyl)-2-[(4-methylbenzoyl)-propan-2-ylamino]dibenzofuran-3-carboxylic acid.
| Compound Name | 8-(methoxymethyl)-2-[(4-methylbenzoyl)-propan-2-ylamino]dibenzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 45255373 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 8-(methoxymethyl)-2-[(4-methylbenzoyl)-propan-2-ylamino]dibenzofuran-3-carboxylic acid |
| SMILES | COCc1ccc2oc3cc(C(=O)O)c(N(C(=O)c4ccc(C)cc4)C(C)C)cc3c2c1 |
| InChI | InChI=1S/C26H25NO5/c1-15(2)27(25(28)18-8-5-16(3)6-9-18)22-12-20-19-11-17(14-31-4)7-10-23(19)32-24(20)13-21(22)26(29)30/h5-13,15H,14H2,1-4H3,(H,29,30) |
| InChIKey | OFLPTUHOQFWYIU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |