C24H26N2O5 — CID 45255642
2-[3-[2-[[ethyl-(2-methoxyacetyl)amino]methyl]quinolin-3-yl]-4-methoxyphenyl]acetic acid (PubChem CID 45255642) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[3-[2-[[ethyl-(2-methoxyacetyl)amino]methyl]quinolin-3-yl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-[[ethyl-(2-methoxyacetyl)amino]methyl]quinolin-3-yl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 45255642 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[3-[2-[[ethyl-(2-methoxyacetyl)amino]methyl]quinolin-3-yl]-4-methoxyphenyl]acetic acid |
| SMILES | CCN(Cc1nc2ccccc2cc1-c1cc(CC(=O)O)ccc1OC)C(=O)COC |
| InChI | InChI=1S/C24H26N2O5/c1-4-26(23(27)15-30-2)14-21-18(13-17-7-5-6-8-20(17)25-21)19-11-16(12-24(28)29)9-10-22(19)31-3/h5-11,13H,4,12,14-15H2,1-3H3,(H,28,29) |
| InChIKey | PIRJIMNCLRGRSJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |