C14H13ClIN3O2 — CID 45257028
3-chloro-N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-5-iodobenzamide (PubChem CID 45257028) has the molecular formula C14H13ClIN3O2 and a molecular weight of 417.63 g/mol. Its IUPAC name is 3-chloro-N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-5-iodobenzamide.
| Compound Name | 3-chloro-N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-5-iodobenzamide |
|---|---|
| PubChem CID | 45257028 |
| Molecular Formula | C14H13ClIN3O2 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | 3-chloro-N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-5-iodobenzamide |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNC(=O)c1cc(Cl)cc(I)c1 |
| InChI | InChI=1S/C14H13ClIN3O2/c15-10-4-9(5-11(16)6-10)14(21)18-8-13(20)19-3-1-2-12(19)7-17/h4-6,12H,1-3,8H2,(H,18,21)/t12-/m0/s1 |
| InChIKey | VHBGZTNZJLRJST-LBPRGKRZSA-N |
| XLogP | 2.19 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|