C14H11Br2NO — CID 45258135
4-[(E)-2-(4-aminophenyl)ethenyl]-2,6-dibromophenol (PubChem CID 45258135) has the molecular formula C14H11Br2NO and a molecular weight of 369.06 g/mol. Its IUPAC name is 4-[(E)-2-(4-aminophenyl)ethenyl]-2,6-dibromophenol.
| Compound Name | 4-[(E)-2-(4-aminophenyl)ethenyl]-2,6-dibromophenol |
|---|---|
| PubChem CID | 45258135 |
| Molecular Formula | C14H11Br2NO |
| Molecular Weight | 369.06 g/mol |
| Exact Mass | 366.92 |
| IUPAC Name | 4-[(E)-2-(4-aminophenyl)ethenyl]-2,6-dibromophenol |
| SMILES | Nc1ccc(/C=C/c2cc(Br)c(O)c(Br)c2)cc1 |
| InChI | InChI=1S/C14H11Br2NO/c15-12-7-10(8-13(16)14(12)18)2-1-9-3-5-11(17)6-4-9/h1-8,18H,17H2/b2-1+ |
| InChIKey | AZVOHBNUGLEXNG-OWOJBTEDSA-N |
| XLogP | 4.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.06 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|