C14H25I — CID 45258499
(3E,5E)-1-iodo-4-methyltrideca-3,5-diene (PubChem CID 45258499) has the molecular formula C14H25I and a molecular weight of 320.26 g/mol. Its IUPAC name is (3E,5E)-1-iodo-4-methyltrideca-3,5-diene.
| Compound Name | (3E,5E)-1-iodo-4-methyltrideca-3,5-diene |
|---|---|
| PubChem CID | 45258499 |
| Molecular Formula | C14H25I |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (3E,5E)-1-iodo-4-methyltrideca-3,5-diene |
| SMILES | CCCCCCC/C=C/C(C)=C/CCI |
| InChI | InChI=1S/C14H25I/c1-3-4-5-6-7-8-9-11-14(2)12-10-13-15/h9,11-12H,3-8,10,13H2,1-2H3/b11-9+,14-12+ |
| InChIKey | KARFFXMYPVYWKD-HUJVCGDBSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|