C34H46N2O10P2 — CID 45258828
1-N,3-N-bis[diethoxyphosphoryl-(4-methoxyphenyl)methyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide (PubChem CID 45258828) has the molecular formula C34H46N2O10P2 and a molecular weight of 704.69 g/mol. Its IUPAC name is 1-N,3-N-bis[diethoxyphosphoryl-(4-methoxyphenyl)methyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[diethoxyphosphoryl-(4-methoxyphenyl)methyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 45258828 |
| Molecular Formula | C34H46N2O10P2 |
| Molecular Weight | 704.69 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | 1-N,3-N-bis[diethoxyphosphoryl-(4-methoxyphenyl)methyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide |
| SMILES | CCOP(=O)(OCC)C(c1ccc(OC)cc1)N(C)C(=O)c1cccc(C(=O)N(C)C(c2ccc(OC)cc2)P(=O)(OCC)OCC)c1 |
| InChI | InChI=1S/C34H46N2O10P2/c1-9-43-47(39,44-10-2)33(25-16-20-29(41-7)21-17-25)35(5)31(37)27-14-13-15-28(24-27)32(38)36(6)34(48(40,45-11-3)46-12-4)26-18-22-30(42-8)23-19-26/h13-24,33-34H,9-12H2,1-8H3 |
| InChIKey | SWPWSSSOYYTAJB-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.69 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|