C10H16ClNO — CID 45259822
2-(aminomethyl)-3,4,6-trimethylphenol;hydrochloride (PubChem CID 45259822) has the molecular formula C10H16ClNO and a molecular weight of 201.70 g/mol. Its IUPAC name is 2-(aminomethyl)-3,4,6-trimethylphenol;hydrochloride.
| Compound Name | 2-(aminomethyl)-3,4,6-trimethylphenol;hydrochloride |
|---|---|
| PubChem CID | 45259822 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-(aminomethyl)-3,4,6-trimethylphenol;hydrochloride |
| SMILES | Cc1cc(C)c(O)c(CN)c1C.Cl |
| InChI | InChI=1S/C10H15NO.ClH/c1-6-4-7(2)10(12)9(5-11)8(6)3;/h4,12H,5,11H2,1-3H3;1H |
| InChIKey | OSMRDDDHYCTHJH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|