C19H22BrClF3N3O — CID 45262053
2-[2-bromo-5-ethyl-3-(trifluoromethoxy)phenyl]-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride (PubChem CID 45262053) has the molecular formula C19H22BrClF3N3O and a molecular weight of 480.76 g/mol. Its IUPAC name is 2-[2-bromo-5-ethyl-3-(trifluoromethoxy)phenyl]-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride.
| Compound Name | 2-[2-bromo-5-ethyl-3-(trifluoromethoxy)phenyl]-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride |
|---|---|
| PubChem CID | 45262053 |
| Molecular Formula | C19H22BrClF3N3O |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 2-[2-bromo-5-ethyl-3-(trifluoromethoxy)phenyl]-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride |
| SMILES | CCc1cccc(N(C)/C(N)=N/c2cc(CC)cc(OC(F)(F)F)c2Br)c1.Cl |
| InChI | InChI=1S/C19H21BrF3N3O.ClH/c1-4-12-7-6-8-14(9-12)26(3)18(24)25-15-10-13(5-2)11-16(17(15)20)27-19(21,22)23;/h6-11H,4-5H2,1-3H3,(H2,24,25);1H |
| InChIKey | MGQMMQBBRZGBTD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|