C17H21ClN2OS — CID 45262886
N,N-dimethyl-3-(10H-phenothiazin-3-yloxy)propan-1-amine;hydrochloride (PubChem CID 45262886) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is N,N-dimethyl-3-(10H-phenothiazin-3-yloxy)propan-1-amine;hydrochloride.
| Compound Name | N,N-dimethyl-3-(10H-phenothiazin-3-yloxy)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 45262886 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N,N-dimethyl-3-(10H-phenothiazin-3-yloxy)propan-1-amine;hydrochloride |
| SMILES | CN(C)CCCOc1ccc2c(c1)Sc1ccccc1N2.Cl |
| InChI | InChI=1S/C17H20N2OS.ClH/c1-19(2)10-5-11-20-13-8-9-15-17(12-13)21-16-7-4-3-6-14(16)18-15;/h3-4,6-9,12,18H,5,10-11H2,1-2H3;1H |
| InChIKey | OAOAZMCOMPHFJW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|