C14H17ClN4O3 — CID 45264362
N-(diaminomethylidene)-1-ethyl-6-methoxy-4-oxoquinoline-3-carboxamide;hydrochloride (PubChem CID 45264362) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is N-(diaminomethylidene)-1-ethyl-6-methoxy-4-oxoquinoline-3-carboxamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-1-ethyl-6-methoxy-4-oxoquinoline-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45264362 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-(diaminomethylidene)-1-ethyl-6-methoxy-4-oxoquinoline-3-carboxamide;hydrochloride |
| SMILES | CCn1cc(C(=O)N=C(N)N)c(=O)c2cc(OC)ccc21.Cl |
| InChI | InChI=1S/C14H16N4O3.ClH/c1-3-18-7-10(13(20)17-14(15)16)12(19)9-6-8(21-2)4-5-11(9)18;/h4-7H,3H2,1-2H3,(H4,15,16,17,20);1H |
| InChIKey | FTMRAGVXBILWCI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|