C26H33ClN2O7 — CID 45264366
(5R,5aR,9S)-9-[2-[dimethylamino(methyl)amino]ethyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one;hydrochloride (PubChem CID 45264366) has the molecular formula C26H33ClN2O7 and a molecular weight of 521.01 g/mol. Its IUPAC name is (5R,5aR,9S)-9-[2-[dimethylamino(methyl)amino]ethyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one;hydrochloride.
| Compound Name | (5R,5aR,9S)-9-[2-[dimethylamino(methyl)amino]ethyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one;hydrochloride |
|---|---|
| PubChem CID | 45264366 |
| Molecular Formula | C26H33ClN2O7 |
| Molecular Weight | 521.01 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | (5R,5aR,9S)-9-[2-[dimethylamino(methyl)amino]ethyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one;hydrochloride |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](CCN(C)N(C)C)C3COC(=O)[C@@H]32)OCO4)cc(OC)c1O.Cl |
| InChI | InChI=1S/C26H32N2O7.ClH/c1-27(2)28(3)7-6-15-16-10-19-20(35-13-34-19)11-17(16)23(24-18(15)12-33-26(24)30)14-8-21(31-4)25(29)22(9-14)32-5;/h8-11,15,18,23-24,29H,6-7,12-13H2,1-5H3;1H/t15-,18?,23-,24+;/m1./s1 |
| InChIKey | LXHSRDIADPWOMZ-SNZJCVSMSA-N |
| XLogP | 3.38 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.01 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|