C26H32ClNO7 — CID 45264396
(5R,5aR,9S)-9-[3-(dimethylamino)propyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one;hydrochloride (PubChem CID 45264396) has the molecular formula C26H32ClNO7 and a molecular weight of 506.00 g/mol. Its IUPAC name is (5R,5aR,9S)-9-[3-(dimethylamino)propyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one;hydrochloride.
| Compound Name | (5R,5aR,9S)-9-[3-(dimethylamino)propyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one;hydrochloride |
|---|---|
| PubChem CID | 45264396 |
| Molecular Formula | C26H32ClNO7 |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | (5R,5aR,9S)-9-[3-(dimethylamino)propyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one;hydrochloride |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](CCCN(C)C)C3COC(=O)[C@@H]32)OCO4)cc(OC)c1O.Cl |
| InChI | InChI=1S/C26H31NO7.ClH/c1-27(2)7-5-6-15-16-10-19-20(34-13-33-19)11-17(16)23(24-18(15)12-32-26(24)29)14-8-21(30-3)25(28)22(9-14)31-4;/h8-11,15,18,23-24,28H,5-7,12-13H2,1-4H3;1H/t15-,18?,23-,24+;/m1./s1 |
| InChIKey | FRZDFHQSGZGLQQ-SNZJCVSMSA-N |
| XLogP | 3.92 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |