C25H40Cl2N4O2 — CID 45265241
1-(1-adamantyl)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]urea;dihydrochloride (PubChem CID 45265241) has the molecular formula C25H40Cl2N4O2 and a molecular weight of 499.53 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]urea;dihydrochloride.
| Compound Name | 1-(1-adamantyl)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]urea;dihydrochloride |
|---|---|
| PubChem CID | 45265241 |
| Molecular Formula | C25H40Cl2N4O2 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 1-(1-adamantyl)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]urea;dihydrochloride |
| SMILES | COc1ccccc1N1CCN(CCCNC(=O)NC23CC4CC(CC(C4)C2)C3)CC1.Cl.Cl |
| InChI | InChI=1S/C25H38N4O2.2ClH/c1-31-23-6-3-2-5-22(23)29-11-9-28(10-12-29)8-4-7-26-24(30)27-25-16-19-13-20(17-25)15-21(14-19)18-25;;/h2-3,5-6,19-21H,4,7-18H2,1H3,(H2,26,27,30);2*1H |
| InChIKey | PMWAJBNEYINHIL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|