C15H14BrN7S — CID 45266149
N-[(E)-[4-(7-methylimidazo[2,1-b][1,3]thiazol-4-ium-6-yl)phenyl]methylideneamino]-1H-1,2,4-triazol-5-amine bromide (PubChem CID 45266149) has the molecular formula C15H14BrN7S and a molecular weight of 404.30 g/mol. Its IUPAC name is N-[(E)-[4-(7-methylimidazo[2,1-b][1,3]thiazol-4-ium-6-yl)phenyl]methylideneamino]-1H-1,2,4-triazol-5-amine bromide.
| Compound Name | N-[(E)-[4-(7-methylimidazo[2,1-b][1,3]thiazol-4-ium-6-yl)phenyl]methylideneamino]-1H-1,2,4-triazol-5-amine bromide |
|---|---|
| PubChem CID | 45266149 |
| Molecular Formula | C15H14BrN7S |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | N-[(E)-[4-(7-methylimidazo[2,1-b][1,3]thiazol-4-ium-6-yl)phenyl]methylideneamino]-1H-1,2,4-triazol-5-amine bromide |
| SMILES | Cn1c(-c2ccc(/C=N/Nc3ncn[nH]3)cc2)c[n+]2ccsc12.[Br-] |
| InChI | InChI=1S/C15H14N7S.BrH/c1-21-13(9-22-6-7-23-15(21)22)12-4-2-11(3-5-12)8-17-19-14-16-10-18-20-14;/h2-10H,1H3,(H2,16,18,19,20);1H/q+1;/p-1/b17-8+; |
| InChIKey | IGBDGFXUWXLKHD-XIDBHWPPSA-M |
| XLogP | -0.94 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|