C20H38O14 — CID 45266818
7-[(2R,3R,5R,6S)-3,5-dihydroxy-2-methyl-6-[(2S,3S,4R,5S)-2,3,5-trihydroxyoxan-4-yl]oxyoxan-3-yl]-5,7-dimethoxyheptane-1,2,3,4-tetrol (PubChem CID 45266818) has the molecular formula C20H38O14 and a molecular weight of 502.51 g/mol. Its IUPAC name is 7-[(2R,3R,5R,6S)-3,5-dihydroxy-2-methyl-6-[(2S,3S,4R,5S)-2,3,5-trihydroxyoxan-4-yl]oxyoxan-3-yl]-5,7-dimethoxyheptane-1,2,3,4-tetrol.
| Compound Name | 7-[(2R,3R,5R,6S)-3,5-dihydroxy-2-methyl-6-[(2S,3S,4R,5S)-2,3,5-trihydroxyoxan-4-yl]oxyoxan-3-yl]-5,7-dimethoxyheptane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 45266818 |
| Molecular Formula | C20H38O14 |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 7-[(2R,3R,5R,6S)-3,5-dihydroxy-2-methyl-6-[(2S,3S,4R,5S)-2,3,5-trihydroxyoxan-4-yl]oxyoxan-3-yl]-5,7-dimethoxyheptane-1,2,3,4-tetrol |
| SMILES | COC(CC(OC)[C@@]1(O)C[C@@H](O)[C@@H](O[C@H]2[C@H](O)[C@@H](O)OC[C@@H]2O)O[C@@H]1C)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C20H38O14/c1-8-20(29,13(31-3)4-12(30-2)15(26)14(25)10(23)6-21)5-9(22)19(33-8)34-17-11(24)7-32-18(28)16(17)27/h8-19,21-29H,4-7H2,1-3H3/t8-,9-,10?,11+,12?,13?,14?,15?,16+,17-,18+,19-,20-/m1/s1 |
| InChIKey | RLLUIOQFQQEFOI-MUZJKTBQSA-N |
| XLogP | -4.84 |
| TPSA | 228.22 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | -4.84 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |