C19H16F6N4O3 — CID 45266973
5-[3,5-bis(trifluoromethyl)phenyl]-1,3,7-trimethyl-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 45266973) has the molecular formula C19H16F6N4O3 and a molecular weight of 462.35 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-1,3,7-trimethyl-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-1,3,7-trimethyl-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 45266973 |
| Molecular Formula | C19H16F6N4O3 |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-1,3,7-trimethyl-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(N)=O)C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2c(n(C)c(=O)n(C)c2=O)N1 |
| InChI | InChI=1S/C19H16F6N4O3/c1-7-11(14(26)30)12(13-15(27-7)28(2)17(32)29(3)16(13)31)8-4-9(18(20,21)22)6-10(5-8)19(23,24)25/h4-6,12,27H,1-3H3,(H2,26,30) |
| InChIKey | AUCWLKKNCBBXKO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |