C19H19N3O8S — CID 45268106
(4-nitrophenyl)methyl (5S,6S)-6-[(1R)-1-(2-acetamidoacetyl)oxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 45268106) has the molecular formula C19H19N3O8S and a molecular weight of 449.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5S,6S)-6-[(1R)-1-(2-acetamidoacetyl)oxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5S,6S)-6-[(1R)-1-(2-acetamidoacetyl)oxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 45268106 |
| Molecular Formula | C19H19N3O8S |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | (4-nitrophenyl)methyl (5S,6S)-6-[(1R)-1-(2-acetamidoacetyl)oxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(=O)NCC(=O)O[C@H](C)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CS[C@@H]12 |
| InChI | InChI=1S/C19H19N3O8S/c1-10(30-15(24)7-20-11(2)23)16-17(25)21-14(9-31-18(16)21)19(26)29-8-12-3-5-13(6-4-12)22(27)28/h3-6,9-10,16,18H,7-8H2,1-2H3,(H,20,23)/t10-,16+,18+/m1/s1 |
| InChIKey | VOWQOZHXRVMDBT-KAWXRDEMSA-N |
| XLogP | 1.08 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|