C22H25F3O4S — CID 45268597
2-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]sulfanylhexanoic acid (PubChem CID 45268597) has the molecular formula C22H25F3O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]sulfanylhexanoic acid.
| Compound Name | 2-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 45268597 |
| Molecular Formula | C22H25F3O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]sulfanylhexanoic acid |
| SMILES | CCCCC(Sc1ccc(OCCCOc2cccc(C(F)(F)F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C22H25F3O4S/c1-2-3-8-20(21(26)27)30-19-11-9-17(10-12-19)28-13-5-14-29-18-7-4-6-16(15-18)22(23,24)25/h4,6-7,9-12,15,20H,2-3,5,8,13-14H2,1H3,(H,26,27) |
| InChIKey | JZYMMZPAPFPFPX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|