C23H33NO2 — CID 45271122
(8S,9S,10R,13S,14S,17R)-17-acetyl-16-(aziridin-1-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 45271122) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-17-acetyl-16-(aziridin-1-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17R)-17-acetyl-16-(aziridin-1-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 45271122 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-17-acetyl-16-(aziridin-1-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1C(N2CC2)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H33NO2/c1-14(25)21-20(24-10-11-24)13-19-17-5-4-15-12-16(26)6-8-22(15,2)18(17)7-9-23(19,21)3/h12,17-21H,4-11,13H2,1-3H3/t17-,18+,19+,20?,21+,22+,23+/m1/s1 |
| InChIKey | AJTIMAJVSIBUNA-VBIOGVOVSA-N |
| XLogP | 4.02 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|