C24H35NO3S — CID 57178448
(8S,9S,10R,13S,14S,17S)-17-acetyl-16-[(2R)-2-amino-3-sulfanylpropanoyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57178448) has the molecular formula C24H35NO3S and a molecular weight of 417.62 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-17-acetyl-16-[(2R)-2-amino-3-sulfanylpropanoyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-17-acetyl-16-[(2R)-2-amino-3-sulfanylpropanoyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57178448 |
| Molecular Formula | C24H35NO3S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-acetyl-16-[(2R)-2-amino-3-sulfanylpropanoyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1C(C(=O)[C@@H](N)CS)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H35NO3S/c1-13(26)21-17(22(28)20(25)12-29)11-19-16-5-4-14-10-15(27)6-8-23(14,2)18(16)7-9-24(19,21)3/h10,16-21,29H,4-9,11-12,25H2,1-3H3/t16-,17?,18+,19+,20+,21+,23+,24+/m1/s1 |
| InChIKey | YTGVSASPWUKPPX-IZMFJASPSA-N |
| XLogP | 3.78 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|