C14H13FN2 — CID 45271766
5-[(E)-2-(4-fluorophenyl)ethenyl]benzene-1,3-diamine (PubChem CID 45271766) has the molecular formula C14H13FN2 and a molecular weight of 228.27 g/mol. Its IUPAC name is 5-[(E)-2-(4-fluorophenyl)ethenyl]benzene-1,3-diamine.
| Compound Name | 5-[(E)-2-(4-fluorophenyl)ethenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 45271766 |
| Molecular Formula | C14H13FN2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 5-[(E)-2-(4-fluorophenyl)ethenyl]benzene-1,3-diamine |
| SMILES | Nc1cc(N)cc(/C=C/c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C14H13FN2/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9H,16-17H2/b2-1+ |
| InChIKey | NHVHRPAEYHNCOA-OWOJBTEDSA-N |
| XLogP | 3.16 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|