C14H9ClF2N2O3S — CID 45271847
6-chloro-4-(3,5-difluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one (PubChem CID 45271847) has the molecular formula C14H9ClF2N2O3S and a molecular weight of 358.75 g/mol. Its IUPAC name is 6-chloro-4-(3,5-difluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one.
| Compound Name | 6-chloro-4-(3,5-difluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 45271847 |
| Molecular Formula | C14H9ClF2N2O3S |
| Molecular Weight | 358.75 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 6-chloro-4-(3,5-difluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2cc(F)cc(F)c2)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C14H9ClF2N2O3S/c15-8-1-2-12-13(3-8)19(7-14(20)18-12)23(21,22)11-5-9(16)4-10(17)6-11/h1-6H,7H2,(H,18,20) |
| InChIKey | QPISGXPPVKQJBH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |