C14H10ClFN2O3S — CID 45271860
6-chloro-4-(3-fluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one (PubChem CID 45271860) has the molecular formula C14H10ClFN2O3S and a molecular weight of 340.76 g/mol. Its IUPAC name is 6-chloro-4-(3-fluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one.
| Compound Name | 6-chloro-4-(3-fluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 45271860 |
| Molecular Formula | C14H10ClFN2O3S |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 6-chloro-4-(3-fluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(F)c2)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C14H10ClFN2O3S/c15-9-4-5-12-13(6-9)18(8-14(19)17-12)22(20,21)11-3-1-2-10(16)7-11/h1-7H,8H2,(H,17,19) |
| InChIKey | URVURUHUCGJLEM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |