C24H19ClN6O4S — CID 4527223
2-[4-[(2-chlorophenyl)diazenyl]-5-(4-nitrophenyl)-3-oxo-1H-pyrazol-2-yl]-5,5-dimethyl-4,6-dihydro-1,3-benzothiazol-7-one (PubChem CID 4527223) has the molecular formula C24H19ClN6O4S and a molecular weight of 522.97 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)diazenyl]-5-(4-nitrophenyl)-3-oxo-1H-pyrazol-2-yl]-5,5-dimethyl-4,6-dihydro-1,3-benzothiazol-7-one.
| Compound Name | 2-[4-[(2-chlorophenyl)diazenyl]-5-(4-nitrophenyl)-3-oxo-1H-pyrazol-2-yl]-5,5-dimethyl-4,6-dihydro-1,3-benzothiazol-7-one |
|---|---|
| PubChem CID | 4527223 |
| Molecular Formula | C24H19ClN6O4S |
| Molecular Weight | 522.97 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)diazenyl]-5-(4-nitrophenyl)-3-oxo-1H-pyrazol-2-yl]-5,5-dimethyl-4,6-dihydro-1,3-benzothiazol-7-one |
| SMILES | CC1(C)CC(=O)c2sc(-n3[nH]c(-c4ccc([N+](=O)[O-])cc4)c(/N=N/c4ccccc4Cl)c3=O)nc2C1 |
| InChI | InChI=1S/C24H19ClN6O4S/c1-24(2)11-17-21(18(32)12-24)36-23(26-17)30-22(33)20(28-27-16-6-4-3-5-15(16)25)19(29-30)13-7-9-14(10-8-13)31(34)35/h3-10,29H,11-12H2,1-2H3/b28-27+ |
| InChIKey | JPYSXNRSVSBIDF-BYYHNAKLSA-N |
| XLogP | 6.42 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.97 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|