C19H22O4S — CID 45273780
2-[4-[3-(2,3-dimethylphenoxy)propoxy]phenyl]sulfanylacetic acid (PubChem CID 45273780) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-[4-[3-(2,3-dimethylphenoxy)propoxy]phenyl]sulfanylacetic acid.
| Compound Name | 2-[4-[3-(2,3-dimethylphenoxy)propoxy]phenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 45273780 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-[4-[3-(2,3-dimethylphenoxy)propoxy]phenyl]sulfanylacetic acid |
| SMILES | Cc1cccc(OCCCOc2ccc(SCC(=O)O)cc2)c1C |
| InChI | InChI=1S/C19H22O4S/c1-14-5-3-6-18(15(14)2)23-12-4-11-22-16-7-9-17(10-8-16)24-13-19(20)21/h3,5-10H,4,11-13H2,1-2H3,(H,20,21) |
| InChIKey | JEALQGSCFFCFEN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|