C47H50O9SSi — CID 45273849
[(2R,3S,4S,5R,6S)-3,4-dibenzoyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]oxan-2-yl]methyl benzoate (PubChem CID 45273849) has the molecular formula C47H50O9SSi and a molecular weight of 819.06 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4-dibenzoyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4-dibenzoyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 45273849 |
| Molecular Formula | C47H50O9SSi |
| Molecular Weight | 819.06 g/mol |
| Exact Mass | 818.29 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4-dibenzoyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]oxan-2-yl]methyl benzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1O[C@H](CSc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H50O9SSi/c1-47(2,3)58(4,5)56-46-42(52-39(33-21-11-6-12-22-33)32-57-37-29-19-10-20-30-37)41(55-45(50)36-27-17-9-18-28-36)40(54-44(49)35-25-15-8-16-26-35)38(53-46)31-51-43(48)34-23-13-7-14-24-34/h6-30,38-42,46H,31-32H2,1-5H3/t38-,39-,40+,41+,42-,46+/m1/s1 |
| InChIKey | WZPFNUCIOXJANW-BOVGASLZSA-N |
| XLogP | 9.96 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.06 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|