C33H42O6SSi — CID 45273858
(4aR,6S,7R,8S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 45273858) has the molecular formula C33H42O6SSi and a molecular weight of 594.85 g/mol. Its IUPAC name is (4aR,6S,7R,8S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (4aR,6S,7R,8S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 45273858 |
| Molecular Formula | C33H42O6SSi |
| Molecular Weight | 594.85 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | (4aR,6S,7R,8S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](O)[C@H]1O[C@H](CSc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H42O6SSi/c1-33(2,3)41(4,5)39-32-30(28(34)29-26(37-32)21-35-31(38-29)24-17-11-7-12-18-24)36-27(23-15-9-6-10-16-23)22-40-25-19-13-8-14-20-25/h6-20,26-32,34H,21-22H2,1-5H3/t26-,27-,28+,29-,30-,31?,32+/m1/s1 |
| InChIKey | UXVCNWQKOVIDJF-VEQAFAARSA-N |
| XLogP | 7.13 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.85 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|