C20H17N3OS — CID 45275172
6-benzyl-2-(3-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 45275172) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is 6-benzyl-2-(3-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-benzyl-2-(3-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 45275172 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 6-benzyl-2-(3-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1cccc(-c2nc(N)c3cc(Cc4ccccc4)sc3n2)c1 |
| InChI | InChI=1S/C20H17N3OS/c1-24-15-9-5-8-14(11-15)19-22-18(21)17-12-16(25-20(17)23-19)10-13-6-3-2-4-7-13/h2-9,11-12H,10H2,1H3,(H2,21,22,23) |
| InChIKey | ULJTUNXFPWCVPW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |