C11H16O2 — CID 45276483
(1R,3aS,5S,6aS)-5-hydroxy-1-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 45276483) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1R,3aS,5S,6aS)-5-hydroxy-1-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (1R,3aS,5S,6aS)-5-hydroxy-1-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 45276483 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1R,3aS,5S,6aS)-5-hydroxy-1-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | C=CC[C@H]1C(=O)C[C@@H]2C[C@H](O)C[C@@H]21 |
| InChI | InChI=1S/C11H16O2/c1-2-3-9-10-6-8(12)4-7(10)5-11(9)13/h2,7-10,12H,1,3-6H2/t7-,8-,9+,10-/m0/s1 |
| InChIKey | KSBOJOBJGKKBLB-QEYWKRMJSA-N |
| XLogP | 1.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|