C32H29F9OS — CID 45279928
[4-[[2,6-difluoro-4-[4-(4-heptylphenyl)phenyl]phenyl]-difluoromethoxy]phenyl]-pentafluoro-λ6-sulfane (PubChem CID 45279928) has the molecular formula C32H29F9OS and a molecular weight of 632.63 g/mol. Its IUPAC name is [4-[[2,6-difluoro-4-[4-(4-heptylphenyl)phenyl]phenyl]-difluoromethoxy]phenyl]-pentafluoro-λ6-sulfane.
| Compound Name | [4-[[2,6-difluoro-4-[4-(4-heptylphenyl)phenyl]phenyl]-difluoromethoxy]phenyl]-pentafluoro-λ6-sulfane |
|---|---|
| PubChem CID | 45279928 |
| Molecular Formula | C32H29F9OS |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | [4-[[2,6-difluoro-4-[4-(4-heptylphenyl)phenyl]phenyl]-difluoromethoxy]phenyl]-pentafluoro-λ6-sulfane |
| SMILES | CCCCCCCc1ccc(-c2ccc(-c3cc(F)c(C(F)(F)Oc4ccc(S(F)(F)(F)(F)F)cc4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C32H29F9OS/c1-2-3-4-5-6-7-22-8-10-23(11-9-22)24-12-14-25(15-13-24)26-20-29(33)31(30(34)21-26)32(35,36)42-27-16-18-28(19-17-27)43(37,38,39,40)41/h8-21H,2-7H2,1H3 |
| InChIKey | LRVFZSXQADKUFL-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|