C26H31ClN4O — CID 45280650
2-(4-chlorophenyl)-5-methyl-4-[[4-(4-piperidin-1-ylphenyl)piperazin-1-yl]methyl]-1,3-oxazole (PubChem CID 45280650) has the molecular formula C26H31ClN4O and a molecular weight of 451.01 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-methyl-4-[[4-(4-piperidin-1-ylphenyl)piperazin-1-yl]methyl]-1,3-oxazole.
| Compound Name | 2-(4-chlorophenyl)-5-methyl-4-[[4-(4-piperidin-1-ylphenyl)piperazin-1-yl]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 45280650 |
| Molecular Formula | C26H31ClN4O |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 2-(4-chlorophenyl)-5-methyl-4-[[4-(4-piperidin-1-ylphenyl)piperazin-1-yl]methyl]-1,3-oxazole |
| SMILES | Cc1oc(-c2ccc(Cl)cc2)nc1CN1CCN(c2ccc(N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C26H31ClN4O/c1-20-25(28-26(32-20)21-5-7-22(27)8-6-21)19-29-15-17-31(18-16-29)24-11-9-23(10-12-24)30-13-3-2-4-14-30/h5-12H,2-4,13-19H2,1H3 |
| InChIKey | WSZFCKDCRIOHOX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|