C16H19BrF3N — CID 45281893
2-(2-bicyclo[2.2.1]heptanyl)-1-[2-bromo-5-(trifluoromethyl)phenyl]ethanamine (PubChem CID 45281893) has the molecular formula C16H19BrF3N and a molecular weight of 362.23 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-[2-bromo-5-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-[2-bromo-5-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 45281893 |
| Molecular Formula | C16H19BrF3N |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-[2-bromo-5-(trifluoromethyl)phenyl]ethanamine |
| SMILES | NC(CC1CC2CCC1C2)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C16H19BrF3N/c17-14-4-3-12(16(18,19)20)8-13(14)15(21)7-11-6-9-1-2-10(11)5-9/h3-4,8-11,15H,1-2,5-7,21H2 |
| InChIKey | YWLPKQAXZPOAFS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |