C13H18BrNS — CID 80535161
2-(2-bicyclo[2.2.1]heptanyl)-1-(3-bromothiophen-2-yl)ethanamine (PubChem CID 80535161) has the molecular formula C13H18BrNS and a molecular weight of 300.27 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-(3-bromothiophen-2-yl)ethanamine.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(3-bromothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 80535161 |
| Molecular Formula | C13H18BrNS |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(3-bromothiophen-2-yl)ethanamine |
| SMILES | NC(CC1CC2CCC1C2)c1sccc1Br |
| InChI | InChI=1S/C13H18BrNS/c14-11-3-4-16-13(11)12(15)7-10-6-8-1-2-9(10)5-8/h3-4,8-10,12H,1-2,5-7,15H2 |
| InChIKey | USEDBYJYINJUAY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |