C13H18FNO2 — CID 45283434
1-(2-fluorophenyl)-2-(oxolan-2-ylmethoxy)ethanamine (PubChem CID 45283434) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-(oxolan-2-ylmethoxy)ethanamine.
| Compound Name | 1-(2-fluorophenyl)-2-(oxolan-2-ylmethoxy)ethanamine |
|---|---|
| PubChem CID | 45283434 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-(2-fluorophenyl)-2-(oxolan-2-ylmethoxy)ethanamine |
| SMILES | NC(COCC1CCCO1)c1ccccc1F |
| InChI | InChI=1S/C13H18FNO2/c14-12-6-2-1-5-11(12)13(15)9-16-8-10-4-3-7-17-10/h1-2,5-6,10,13H,3-4,7-9,15H2 |
| InChIKey | MKOXEFWMWYNBIA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |