C17H32ClNO2 — CID 45283743
1-(2-bicyclo[2.2.1]heptanylmethoxy)-3-(3-methylpiperidin-1-yl)propan-2-ol;hydrochloride (PubChem CID 45283743) has the molecular formula C17H32ClNO2 and a molecular weight of 317.90 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanylmethoxy)-3-(3-methylpiperidin-1-yl)propan-2-ol;hydrochloride.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanylmethoxy)-3-(3-methylpiperidin-1-yl)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 45283743 |
| Molecular Formula | C17H32ClNO2 |
| Molecular Weight | 317.90 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanylmethoxy)-3-(3-methylpiperidin-1-yl)propan-2-ol;hydrochloride |
| SMILES | CC1CCCN(CC(O)COCC2CC3CCC2C3)C1.Cl |
| InChI | InChI=1S/C17H31NO2.ClH/c1-13-3-2-6-18(9-13)10-17(19)12-20-11-16-8-14-4-5-15(16)7-14;/h13-17,19H,2-12H2,1H3;1H |
| InChIKey | QIWWQIQGUUSCIP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.90 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |