C17H20Cl2N4O — CID 45284327
[4-[1-(3-chlorophenyl)imidazol-2-yl]piperazin-1-yl]-cyclopropylmethanone;hydrochloride (PubChem CID 45284327) has the molecular formula C17H20Cl2N4O and a molecular weight of 367.28 g/mol. Its IUPAC name is [4-[1-(3-chlorophenyl)imidazol-2-yl]piperazin-1-yl]-cyclopropylmethanone;hydrochloride.
| Compound Name | [4-[1-(3-chlorophenyl)imidazol-2-yl]piperazin-1-yl]-cyclopropylmethanone;hydrochloride |
|---|---|
| PubChem CID | 45284327 |
| Molecular Formula | C17H20Cl2N4O |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [4-[1-(3-chlorophenyl)imidazol-2-yl]piperazin-1-yl]-cyclopropylmethanone;hydrochloride |
| SMILES | Cl.O=C(C1CC1)N1CCN(c2nccn2-c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H19ClN4O.ClH/c18-14-2-1-3-15(12-14)22-7-6-19-17(22)21-10-8-20(9-11-21)16(23)13-4-5-13;/h1-3,6-7,12-13H,4-5,8-11H2;1H |
| InChIKey | VMJZHRQIEZAHMD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |