C19H15FN8O3S — CID 4529363
N-(2-fluorophenyl)-2-[[5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4529363) has the molecular formula C19H15FN8O3S and a molecular weight of 454.45 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[[5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[[5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4529363 |
| Molecular Formula | C19H15FN8O3S |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-(2-fluorophenyl)-2-[[5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(Cn2cnc([N+](=O)[O-])n2)n1-c1ccccc1)Nc1ccccc1F |
| InChI | InChI=1S/C19H15FN8O3S/c20-14-8-4-5-9-15(14)22-17(29)11-32-19-24-23-16(27(19)13-6-2-1-3-7-13)10-26-12-21-18(25-26)28(30)31/h1-9,12H,10-11H2,(H,22,29) |
| InChIKey | SCLADPGYLUTQEL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|