C22H16BrN3O3 — CID 4534549
2-(1-bromonaphthalen-2-yl)oxy-N-[(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide (PubChem CID 4534549) has the molecular formula C22H16BrN3O3 and a molecular weight of 450.29 g/mol. Its IUPAC name is 2-(1-bromonaphthalen-2-yl)oxy-N-[(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(1-bromonaphthalen-2-yl)oxy-N-[(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4534549 |
| Molecular Formula | C22H16BrN3O3 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 2-(1-bromonaphthalen-2-yl)oxy-N-[(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccc2ccccc2c1Br)NN=Cc1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C22H16BrN3O3/c23-21-17-7-3-1-5-14(17)9-10-19(21)29-13-20(27)26-24-12-16-11-15-6-2-4-8-18(15)25-22(16)28/h1-12H,13H2,(H,25,28)(H,26,27) |
| InChIKey | JFPKZLQTCRFUEX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|