C19H13Br3N2O3 — CID 3350497
N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(1,6-dibromonaphthalen-2-yl)oxyacetamide (PubChem CID 3350497) has the molecular formula C19H13Br3N2O3 and a molecular weight of 557.04 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(1,6-dibromonaphthalen-2-yl)oxyacetamide.
| Compound Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(1,6-dibromonaphthalen-2-yl)oxyacetamide |
|---|---|
| PubChem CID | 3350497 |
| Molecular Formula | C19H13Br3N2O3 |
| Molecular Weight | 557.04 g/mol |
| Exact Mass | 553.85 |
| IUPAC Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(1,6-dibromonaphthalen-2-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2cc(Br)ccc2c1Br)NN=Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C19H13Br3N2O3/c20-13-2-4-15-11(7-13)1-6-17(19(15)22)27-10-18(26)24-23-9-12-8-14(21)3-5-16(12)25/h1-9,25H,10H2,(H,24,26) |
| InChIKey | ADTDNBNNABDZCV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.04 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|