C18H14Br2N2O2S — CID 3349452
2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(3-methylthiophen-2-yl)methylideneamino]acetamide (PubChem CID 3349452) has the molecular formula C18H14Br2N2O2S and a molecular weight of 482.20 g/mol. Its IUPAC name is 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(3-methylthiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(3-methylthiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3349452 |
| Molecular Formula | C18H14Br2N2O2S |
| Molecular Weight | 482.20 g/mol |
| Exact Mass | 479.91 |
| IUPAC Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(3-methylthiophen-2-yl)methylideneamino]acetamide |
| SMILES | Cc1ccsc1C=NNC(=O)COc1ccc2cc(Br)ccc2c1Br |
| InChI | InChI=1S/C18H14Br2N2O2S/c1-11-6-7-25-16(11)9-21-22-17(23)10-24-15-5-2-12-8-13(19)3-4-14(12)18(15)20/h2-9H,10H2,1H3,(H,22,23) |
| InChIKey | IFYSPTVMPZHCST-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.20 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|