C20H16Br2N2O2S — CID 3350501
2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(4-methylsulfanylphenyl)methylideneamino]acetamide (PubChem CID 3350501) has the molecular formula C20H16Br2N2O2S and a molecular weight of 508.24 g/mol. Its IUPAC name is 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(4-methylsulfanylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(4-methylsulfanylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3350501 |
| Molecular Formula | C20H16Br2N2O2S |
| Molecular Weight | 508.24 g/mol |
| Exact Mass | 505.93 |
| IUPAC Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(4-methylsulfanylphenyl)methylideneamino]acetamide |
| SMILES | CSc1ccc(C=NNC(=O)COc2ccc3cc(Br)ccc3c2Br)cc1 |
| InChI | InChI=1S/C20H16Br2N2O2S/c1-27-16-6-2-13(3-7-16)11-23-24-19(25)12-26-18-9-4-14-10-15(21)5-8-17(14)20(18)22/h2-11H,12H2,1H3,(H,24,25) |
| InChIKey | UVZQWGOGFSIHSU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.24 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|